C7H12NO4S- — CID 19690629
2-(prop-2-enoylamino)butane-1-sulfonate (PubChem CID 19690629) has the molecular formula C7H12NO4S- and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(prop-2-enoylamino)butane-1-sulfonate.
| Compound Name | 2-(prop-2-enoylamino)butane-1-sulfonate |
|---|---|
| PubChem CID | 19690629 |
| Molecular Formula | C7H12NO4S- |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-(prop-2-enoylamino)butane-1-sulfonate |
| SMILES | C=CC(=O)NC(CC)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H13NO4S/c1-3-6(5-13(10,11)12)8-7(9)4-2/h4,6H,2-3,5H2,1H3,(H,8,9)(H,10,11,12)/p-1 |
| InChIKey | YQSVYZPYIXAYND-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|