C7H14NNaO5S — CID 23683370
sodium;N-butan-2-ylprop-2-enamide;hydrogen sulfate (PubChem CID 23683370) has the molecular formula C7H14NNaO5S and a molecular weight of 247.25 g/mol. Its IUPAC name is sodium;N-butan-2-ylprop-2-enamide;hydrogen sulfate.
| Compound Name | sodium;N-butan-2-ylprop-2-enamide;hydrogen sulfate |
|---|---|
| PubChem CID | 23683370 |
| Molecular Formula | C7H14NNaO5S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | sodium;N-butan-2-ylprop-2-enamide;hydrogen sulfate |
| SMILES | C=CC(=O)NC(C)CC.O=S(=O)([O-])O.[Na+] |
| InChI | InChI=1S/C7H13NO.Na.H2O4S/c1-4-6(3)8-7(9)5-2;;1-5(2,3)4/h5-6H,2,4H2,1,3H3,(H,8,9);;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | DUJZNVXTIYHEGZ-UHFFFAOYSA-M |
| XLogP | -2.90 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|