C6H12N2O3S — CID 167837204
N-[(2S)-1-sulfamoylpropan-2-yl]prop-2-enamide (PubChem CID 167837204) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is N-[(2S)-1-sulfamoylpropan-2-yl]prop-2-enamide.
| Compound Name | N-[(2S)-1-sulfamoylpropan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167837204 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | N-[(2S)-1-sulfamoylpropan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H](C)CS(N)(=O)=O |
| InChI | InChI=1S/C6H12N2O3S/c1-3-6(9)8-5(2)4-12(7,10)11/h3,5H,1,4H2,2H3,(H,8,9)(H2,7,10,11)/t5-/m0/s1 |
| InChIKey | CBXCKIMEHVLYIM-YFKPBYRVSA-N |
| XLogP | -1.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|