C9H11F6NO5S2 — CID 89253772
N-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]prop-2-enamide (PubChem CID 89253772) has the molecular formula C9H11F6NO5S2 and a molecular weight of 391.31 g/mol. Its IUPAC name is N-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]prop-2-enamide.
| Compound Name | N-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89253772 |
| Molecular Formula | C9H11F6NO5S2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | N-[4,4-bis(trifluoromethylsulfonyl)butan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H11F6NO5S2/c1-3-6(17)16-5(2)4-7(22(18,19)8(10,11)12)23(20,21)9(13,14)15/h3,5,7H,1,4H2,2H3,(H,16,17) |
| InChIKey | RYAZUVPKPQFQOF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|