C12H14F6O9S2 — CID 58193518
2-[4,4-bis(trifluoromethylsulfonyl)butan-2-yloxycarbonyloxy]ethyl prop-2-enoate (PubChem CID 58193518) has the molecular formula C12H14F6O9S2 and a molecular weight of 480.36 g/mol. Its IUPAC name is 2-[4,4-bis(trifluoromethylsulfonyl)butan-2-yloxycarbonyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[4,4-bis(trifluoromethylsulfonyl)butan-2-yloxycarbonyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 58193518 |
| Molecular Formula | C12H14F6O9S2 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 2-[4,4-bis(trifluoromethylsulfonyl)butan-2-yloxycarbonyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)OC(C)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O9S2/c1-3-8(19)25-4-5-26-10(20)27-7(2)6-9(28(21,22)11(13,14)15)29(23,24)12(16,17)18/h3,7,9H,1,4-6H2,2H3 |
| InChIKey | ZCHMGQAGCDAATK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|