C10H12F6O6S2 — CID 89253768
[3-methyl-4,4-bis(trifluoromethylsulfonyl)butan-2-yl] prop-2-enoate (PubChem CID 89253768) has the molecular formula C10H12F6O6S2 and a molecular weight of 406.32 g/mol. Its IUPAC name is [3-methyl-4,4-bis(trifluoromethylsulfonyl)butan-2-yl] prop-2-enoate.
| Compound Name | [3-methyl-4,4-bis(trifluoromethylsulfonyl)butan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 89253768 |
| Molecular Formula | C10H12F6O6S2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | [3-methyl-4,4-bis(trifluoromethylsulfonyl)butan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)C(C)C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F6O6S2/c1-4-7(17)22-6(3)5(2)8(23(18,19)9(11,12)13)24(20,21)10(14,15)16/h4-6,8H,1H2,2-3H3 |
| InChIKey | DBPWSZVOFTVJTH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|