C8H7F7O3 — CID 154160428
1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethyl prop-2-enoate (PubChem CID 154160428) has the molecular formula C8H7F7O3 and a molecular weight of 284.13 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethyl prop-2-enoate.
| Compound Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 154160428 |
| Molecular Formula | C8H7F7O3 |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7F7O3/c1-3-5(16)17-4(2)18-6(9,7(10,11)12)8(13,14)15/h3-4H,1H2,2H3 |
| InChIKey | UMACCFAOEVCRLC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|