C12H10F8O4 — CID 54347670
(2,2,3,3,4,4,5,5-octafluoro-1-prop-2-enoyloxyhexyl) prop-2-enoate (PubChem CID 54347670) has the molecular formula C12H10F8O4 and a molecular weight of 370.19 g/mol. Its IUPAC name is (2,2,3,3,4,4,5,5-octafluoro-1-prop-2-enoyloxyhexyl) prop-2-enoate.
| Compound Name | (2,2,3,3,4,4,5,5-octafluoro-1-prop-2-enoyloxyhexyl) prop-2-enoate |
|---|---|
| PubChem CID | 54347670 |
| Molecular Formula | C12H10F8O4 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (2,2,3,3,4,4,5,5-octafluoro-1-prop-2-enoyloxyhexyl) prop-2-enoate |
| SMILES | C=CC(=O)OC(OC(=O)C=C)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C12H10F8O4/c1-4-6(21)23-8(24-7(22)5-2)10(15,16)12(19,20)11(17,18)9(3,13)14/h4-5,8H,1-2H2,3H3 |
| InChIKey | UDKYUCSMIYESKQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|