C12H5F17O2 — CID 22465163
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorononyl prop-2-enoate (PubChem CID 22465163) has the molecular formula C12H5F17O2 and a molecular weight of 504.14 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorononyl prop-2-enoate.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorononyl prop-2-enoate |
|---|---|
| PubChem CID | 22465163 |
| Molecular Formula | C12H5F17O2 |
| Molecular Weight | 504.14 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorononyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H5F17O2/c1-2-3(30)31-5(15)7(18,19)9(22,23)11(26,27)12(28,29)10(24,25)8(20,21)6(16,17)4(13)14/h2,4-5H,1H2 |
| InChIKey | RRZPTGKJDFBIKX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.14 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|