C7H10F6O2Si — CID 175090999
1,2,2,3,4,4-hexafluorobutyl prop-2-enoate;silane (PubChem CID 175090999) has the molecular formula C7H10F6O2Si and a molecular weight of 268.23 g/mol. Its IUPAC name is 1,2,2,3,4,4-hexafluorobutyl prop-2-enoate;silane.
| Compound Name | 1,2,2,3,4,4-hexafluorobutyl prop-2-enoate;silane |
|---|---|
| PubChem CID | 175090999 |
| Molecular Formula | C7H10F6O2Si |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 1,2,2,3,4,4-hexafluorobutyl prop-2-enoate;silane |
| SMILES | C=CC(=O)OC(F)C(F)(F)C(F)C(F)F.[SiH4] |
| InChI | InChI=1S/C7H6F6O2.H4Si/c1-2-3(14)15-6(11)7(12,13)4(8)5(9)10;/h2,4-6H,1H2;1H4 |
| InChIKey | NLGGNNUFQJSBHA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|