About 1-fluoroprop-2-enyl prop-2-enoate
1-fluoroprop-2-enyl prop-2-enoate (PubChem CID 87065178) has the molecular formula C6H7FO2
and a molecular weight of 130.12 g/mol. Its IUPAC name is 1-fluoroprop-2-enyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-fluoroprop-2-enyl prop-2-enoate |
| PubChem CID | 87065178 |
| Molecular Formula | C6H7FO2 |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 1-fluoroprop-2-enyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)C=C |
| InChI | InChI=1S/C6H7FO2/c1-3-5(7)9-6(8)4-2/h3-5H,1-2H2 |
| InChIKey | VRZUVZLWVDKCRU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroprop-2-enyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroprop-2-enyl prop-2-enoate?
The IUPAC name of 1-fluoroprop-2-enyl prop-2-enoate (CID 87065178) is 1-fluoroprop-2-enyl prop-2-enoate.
What is the SMILES notation for 1-fluoroprop-2-enyl prop-2-enoate?
The canonical SMILES for 1-fluoroprop-2-enyl prop-2-enoate is C=CC(=O)OC(F)C=C.
What is the InChIKey of 1-fluoroprop-2-enyl prop-2-enoate?
The InChIKey is VRZUVZLWVDKCRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FO2/c1-3-5(7)9-6(8)4-2/h3-5H,1-2H2.
What are the key properties of 1-fluoroprop-2-enyl prop-2-enoate?
1-fluoroprop-2-enyl prop-2-enoate has a molecular weight of 130.12 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroprop-2-enyl prop-2-enoate is sourced from PubChem (CID 87065178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).