C12H10F12O2 — CID 135341747
1,2,2,3,3,4,5,6,7,8,9,9-dodecafluorononyl prop-2-enoate (PubChem CID 135341747) has the molecular formula C12H10F12O2 and a molecular weight of 414.19 g/mol. Its IUPAC name is 1,2,2,3,3,4,5,6,7,8,9,9-dodecafluorononyl prop-2-enoate.
| Compound Name | 1,2,2,3,3,4,5,6,7,8,9,9-dodecafluorononyl prop-2-enoate |
|---|---|
| PubChem CID | 135341747 |
| Molecular Formula | C12H10F12O2 |
| Molecular Weight | 414.19 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 1,2,2,3,3,4,5,6,7,8,9,9-dodecafluorononyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C12H10F12O2/c1-2-3(25)26-10(20)12(23,24)11(21,22)8(17)6(15)4(13)5(14)7(16)9(18)19/h2,4-10H,1H2 |
| InChIKey | VWKHUROLKFUBAS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|