C11H6F16O2 — CID 174997199
fluoro 2,2,3,3,4,4,5,5,6,7,8,9,10,11,11-pentadecafluoroundecanoate (PubChem CID 174997199) has the molecular formula C11H6F16O2 and a molecular weight of 474.14 g/mol. Its IUPAC name is fluoro 2,2,3,3,4,4,5,5,6,7,8,9,10,11,11-pentadecafluoroundecanoate.
| Compound Name | fluoro 2,2,3,3,4,4,5,5,6,7,8,9,10,11,11-pentadecafluoroundecanoate |
|---|---|
| PubChem CID | 174997199 |
| Molecular Formula | C11H6F16O2 |
| Molecular Weight | 474.14 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | fluoro 2,2,3,3,4,4,5,5,6,7,8,9,10,11,11-pentadecafluoroundecanoate |
| SMILES | O=C(OF)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C11H6F16O2/c12-1(2(13)4(15)6(17)18)3(14)5(16)8(19,20)10(23,24)11(25,26)9(21,22)7(28)29-27/h1-6H |
| InChIKey | MICSATRTLMFOTR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.14 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|