C11H8F15KO3S — CID 134206791
potassium 1,2,2,3,3,4,4,5,6,7,8,9,10,11,11-pentadecafluoroundecane-1-sulfonate (PubChem CID 134206791) has the molecular formula C11H8F15KO3S and a molecular weight of 544.32 g/mol. Its IUPAC name is potassium 1,2,2,3,3,4,4,5,6,7,8,9,10,11,11-pentadecafluoroundecane-1-sulfonate.
| Compound Name | potassium 1,2,2,3,3,4,4,5,6,7,8,9,10,11,11-pentadecafluoroundecane-1-sulfonate |
|---|---|
| PubChem CID | 134206791 |
| Molecular Formula | C11H8F15KO3S |
| Molecular Weight | 544.32 g/mol |
| Exact Mass | 543.96 |
| IUPAC Name | potassium 1,2,2,3,3,4,4,5,6,7,8,9,10,11,11-pentadecafluoroundecane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)F.[K+] |
| InChI | InChI=1S/C11H9F15O3S.K/c12-1(3(14)5(16)7(18)19)2(13)4(15)6(17)9(21,22)11(25,26)10(23,24)8(20)30(27,28)29;/h1-8H,(H,27,28,29);/q;+1/p-1 |
| InChIKey | QICKSEWSVWNPLY-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|