C8H3F14LiO3S — CID 134206668
lithium 1,2,2,3,3,4,4,5,5,6,6,7,8,8-tetradecafluorooctane-1-sulfonate (PubChem CID 134206668) has the molecular formula C8H3F14LiO3S and a molecular weight of 452.09 g/mol. Its IUPAC name is lithium 1,2,2,3,3,4,4,5,5,6,6,7,8,8-tetradecafluorooctane-1-sulfonate.
| Compound Name | lithium 1,2,2,3,3,4,4,5,5,6,6,7,8,8-tetradecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 134206668 |
| Molecular Formula | C8H3F14LiO3S |
| Molecular Weight | 452.09 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | lithium 1,2,2,3,3,4,4,5,5,6,6,7,8,8-tetradecafluorooctane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)F.[Li+] |
| InChI | InChI=1S/C8H4F14O3S.Li/c9-1(2(10)11)4(13,14)6(17,18)8(21,22)7(19,20)5(15,16)3(12)26(23,24)25;/h1-3H,(H,23,24,25);/q;+1/p-1 |
| InChIKey | OWGHCARVDNKDHU-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.09 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|