C4H3F6KO3S — CID 134206422
potassium 1,2,2,3,4,4-hexafluorobutane-1-sulfonate (PubChem CID 134206422) has the molecular formula C4H3F6KO3S and a molecular weight of 284.22 g/mol. Its IUPAC name is potassium 1,2,2,3,4,4-hexafluorobutane-1-sulfonate.
| Compound Name | potassium 1,2,2,3,4,4-hexafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 134206422 |
| Molecular Formula | C4H3F6KO3S |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | potassium 1,2,2,3,4,4-hexafluorobutane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)C(F)F.[K+] |
| InChI | InChI=1S/C4H4F6O3S.K/c5-1(2(6)7)4(9,10)3(8)14(11,12)13;/h1-3H,(H,11,12,13);/q;+1/p-1 |
| InChIKey | BABVLPPYXRNCFC-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|