C8H7F10KO3S — CID 134207096
potassium 1,2,2,3,4,5,6,7,8,8-decafluorooctane-1-sulfonate (PubChem CID 134207096) has the molecular formula C8H7F10KO3S and a molecular weight of 412.29 g/mol. Its IUPAC name is potassium 1,2,2,3,4,5,6,7,8,8-decafluorooctane-1-sulfonate.
| Compound Name | potassium 1,2,2,3,4,5,6,7,8,8-decafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 134207096 |
| Molecular Formula | C8H7F10KO3S |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | potassium 1,2,2,3,4,5,6,7,8,8-decafluorooctane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)C(F)C(F)C(F)C(F)C(F)F.[K+] |
| InChI | InChI=1S/C8H8F10O3S.K/c9-1(2(10)4(12)6(14)15)3(11)5(13)8(17,18)7(16)22(19,20)21;/h1-7H,(H,19,20,21);/q;+1/p-1 |
| InChIKey | QCTQKHTYWLWTFX-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|