C7H4F11LiO3S — CID 134207102
lithium 1,2,2,3,3,4,4,5,6,7,7-undecafluoroheptane-1-sulfonate (PubChem CID 134207102) has the molecular formula C7H4F11LiO3S and a molecular weight of 384.09 g/mol. Its IUPAC name is lithium 1,2,2,3,3,4,4,5,6,7,7-undecafluoroheptane-1-sulfonate.
| Compound Name | lithium 1,2,2,3,3,4,4,5,6,7,7-undecafluoroheptane-1-sulfonate |
|---|---|
| PubChem CID | 134207102 |
| Molecular Formula | C7H4F11LiO3S |
| Molecular Weight | 384.09 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | lithium 1,2,2,3,3,4,4,5,6,7,7-undecafluoroheptane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F.[Li+] |
| InChI | InChI=1S/C7H5F11O3S.Li/c8-1(3(10)11)2(9)5(13,14)7(17,18)6(15,16)4(12)22(19,20)21;/h1-4H,(H,19,20,21);/q;+1/p-1 |
| InChIKey | SWQQDELZRACEKX-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.09 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|