C16H23F14NO3S — CID 134206597
1,2,2,3,3,4,4,5,5,6,6,7,8,8-tetradecafluorooctane-1-sulfonate;tetraethylazanium (PubChem CID 134206597) has the molecular formula C16H23F14NO3S and a molecular weight of 575.40 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,8,8-tetradecafluorooctane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,8,8-tetradecafluorooctane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 134206597 |
| Molecular Formula | C16H23F14NO3S |
| Molecular Weight | 575.40 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,8,8-tetradecafluorooctane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C8H4F14O3S.C8H20N/c9-1(2(10)11)4(13,14)6(17,18)8(21,22)7(19,20)5(15,16)3(12)26(23,24)25;1-5-9(6-2,7-3)8-4/h1-3H,(H,23,24,25);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | YOECAYZUNIWAHD-UHFFFAOYSA-M |
| XLogP | 5.49 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|