C12H4F21KO3S — CID 134206795
potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,12,12-henicosafluorododecane-1-sulfonate (PubChem CID 134206795) has the molecular formula C12H4F21KO3S and a molecular weight of 666.28 g/mol. Its IUPAC name is potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,12,12-henicosafluorododecane-1-sulfonate.
| Compound Name | potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,12,12-henicosafluorododecane-1-sulfonate |
|---|---|
| PubChem CID | 134206795 |
| Molecular Formula | C12H4F21KO3S |
| Molecular Weight | 666.28 g/mol |
| Exact Mass | 665.92 |
| IUPAC Name | potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,12,12-henicosafluorododecane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F.[K+] |
| InChI | InChI=1S/C12H5F21O3S.K/c13-1(3(15)16)2(14)5(18,19)7(22,23)9(26,27)11(30,31)12(32,33)10(28,29)8(24,25)6(20,21)4(17)37(34,35)36;/h1-4H,(H,34,35,36);/q;+1/p-1 |
| InChIKey | JNSPTYHWRPFFDA-UHFFFAOYSA-M |
| XLogP | 2.85 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|