C7H5F10LiO3S — CID 134207484
lithium 1,2,2,3,3,4,5,6,7,7-decafluoroheptane-1-sulfonate (PubChem CID 134207484) has the molecular formula C7H5F10LiO3S and a molecular weight of 366.10 g/mol. Its IUPAC name is lithium 1,2,2,3,3,4,5,6,7,7-decafluoroheptane-1-sulfonate.
| Compound Name | lithium 1,2,2,3,3,4,5,6,7,7-decafluoroheptane-1-sulfonate |
|---|---|
| PubChem CID | 134207484 |
| Molecular Formula | C7H5F10LiO3S |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | lithium 1,2,2,3,3,4,5,6,7,7-decafluoroheptane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)F.[Li+] |
| InChI | InChI=1S/C7H6F10O3S.Li/c8-1(2(9)4(11)12)3(10)6(14,15)7(16,17)5(13)21(18,19)20;/h1-5H,(H,18,19,20);/q;+1/p-1 |
| InChIKey | RQSYZURREOTUQD-UHFFFAOYSA-M |
| XLogP | -0.62 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|