C6H5F8KO3S — CID 134206944
potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate (PubChem CID 134206944) has the molecular formula C6H5F8KO3S and a molecular weight of 348.25 g/mol. Its IUPAC name is potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate.
| Compound Name | potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 134206944 |
| Molecular Formula | C6H5F8KO3S |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)C(F)C(F)C(F)F.[K+] |
| InChI | InChI=1S/C6H6F8O3S.K/c7-1(2(8)4(10)11)3(9)6(13,14)5(12)18(15,16)17;/h1-5H,(H,15,16,17);/q;+1/p-1 |
| InChIKey | NNMHHHGBJPXGLH-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|