potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate

C6H5F8KO3S — CID 134206944

IUPACpotassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate
SMILESO=S(=O)([O-])C(F)C(F)(F)C(F)C(F)C(F)C(F)F.[K+]
InChIInChI=1S/C6H6F8O3S.K/c7-1(2(8)4(10)11)3(9)6(13,14)5(12)18(15,16)17;/h1-5H,(H,15,16,17);/q;+1/p-1
InChIKeyNNMHHHGBJPXGLH-UHFFFAOYSA-M
MW348.25 g/mol
LogP-1.25
Rot. Bonds6

About potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate

potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate (PubChem CID 134206944) has the molecular formula C6H5F8KO3S and a molecular weight of 348.25 g/mol. Its IUPAC name is potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate.

Molecular Properties

Compound Namepotassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate
PubChem CID134206944
Molecular FormulaC6H5F8KO3S
Molecular Weight348.25 g/mol
Exact Mass347.95
IUPAC Namepotassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate
SMILESO=S(=O)([O-])C(F)C(F)(F)C(F)C(F)C(F)C(F)F.[K+]
InChIInChI=1S/C6H6F8O3S.K/c7-1(2(8)4(10)11)3(9)6(13,14)5(12)18(15,16)17;/h1-5H,(H,15,16,17);/q;+1/p-1
InChIKeyNNMHHHGBJPXGLH-UHFFFAOYSA-M
XLogP-1.25
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.25
LogP ≤ 5-1.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate?
The IUPAC name of potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate (CID 134206944) is potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate.
What is the SMILES notation for potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate?
The canonical SMILES for potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate is O=S(=O)([O-])C(F)C(F)(F)C(F)C(F)C(F)C(F)F.[K+].
What is the InChIKey of potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate?
The InChIKey is NNMHHHGBJPXGLH-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6F8O3S.K/c7-1(2(8)4(10)11)3(9)6(13,14)5(12)18(15,16)17;/h1-5H,(H,15,16,17);/q;+1/p-1.
What are the key properties of potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate?
potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate has a molecular weight of 348.25 g/mol, XLogP of -1.25, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1,2,2,3,4,5,6,6-octafluorohexane-1-sulfonate is sourced from PubChem (CID 134206944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).