C10H5F16KO3S — CID 134206568
potassium 1,2,2,3,3,4,4,5,5,6,6,7,8,9,10,10-hexadecafluorodecane-1-sulfonate (PubChem CID 134206568) has the molecular formula C10H5F16KO3S and a molecular weight of 548.28 g/mol. Its IUPAC name is potassium 1,2,2,3,3,4,4,5,5,6,6,7,8,9,10,10-hexadecafluorodecane-1-sulfonate.
| Compound Name | potassium 1,2,2,3,3,4,4,5,5,6,6,7,8,9,10,10-hexadecafluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 134206568 |
| Molecular Formula | C10H5F16KO3S |
| Molecular Weight | 548.28 g/mol |
| Exact Mass | 547.93 |
| IUPAC Name | potassium 1,2,2,3,3,4,4,5,5,6,6,7,8,9,10,10-hexadecafluorodecane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)F.[K+] |
| InChI | InChI=1S/C10H6F16O3S.K/c11-1(2(12)4(14)15)3(13)6(17,18)8(21,22)10(25,26)9(23,24)7(19,20)5(16)30(27,28)29;/h1-5H,(H,27,28,29);/q;+1/p-1 |
| InChIKey | KNNAOZYRHBIXCV-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|