C8HF16KO3S — CID 134207418
potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctane-1-sulfonate (PubChem CID 134207418) has the molecular formula C8HF16KO3S and a molecular weight of 520.23 g/mol. Its IUPAC name is potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctane-1-sulfonate.
| Compound Name | potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 134207418 |
| Molecular Formula | C8HF16KO3S |
| Molecular Weight | 520.23 g/mol |
| Exact Mass | 519.90 |
| IUPAC Name | potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C8H2F16O3S.K/c9-1(28(25,26)27)2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24;/h1H,(H,25,26,27);/q;+1/p-1 |
| InChIKey | WJOYKGBMBCHYOW-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|