C7HF14KO3S — CID 134206654
potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptane-1-sulfonate (PubChem CID 134206654) has the molecular formula C7HF14KO3S and a molecular weight of 470.22 g/mol. Its IUPAC name is potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptane-1-sulfonate.
| Compound Name | potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptane-1-sulfonate |
|---|---|
| PubChem CID | 134206654 |
| Molecular Formula | C7HF14KO3S |
| Molecular Weight | 470.22 g/mol |
| Exact Mass | 469.91 |
| IUPAC Name | potassium 1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C7H2F14O3S.K/c8-1(25(22,23)24)2(9,10)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)21;/h1H,(H,22,23,24);/q;+1/p-1 |
| InChIKey | ACDLPQRKIBXVNL-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|