C18H24F17NO3S — CID 134207025
1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecane-1-sulfonate;tetraethylazanium (PubChem CID 134207025) has the molecular formula C18H24F17NO3S and a molecular weight of 657.43 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 134207025 |
| Molecular Formula | C18H24F17NO3S |
| Molecular Weight | 657.43 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C10H5F17O3S.C8H20N/c11-1(3(13)14)2(12)5(16,17)7(20,21)9(24,25)10(26,27)8(22,23)6(18,19)4(15)31(28,29)30;1-5-9(6-2,7-3)8-4/h1-4H,(H,28,29,30);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | YMSMZQITYLBEFN-UHFFFAOYSA-M |
| XLogP | 6.46 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.43 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|