C19H28F15NO3S — CID 134207049
1,2,2,3,3,4,4,5,6,7,8,9,10,11,11-pentadecafluoroundecane-1-sulfonate;tetraethylazanium (PubChem CID 134207049) has the molecular formula C19H28F15NO3S and a molecular weight of 635.47 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,6,7,8,9,10,11,11-pentadecafluoroundecane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,2,2,3,3,4,4,5,6,7,8,9,10,11,11-pentadecafluoroundecane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 134207049 |
| Molecular Formula | C19H28F15NO3S |
| Molecular Weight | 635.47 g/mol |
| Exact Mass | 635.16 |
| IUPAC Name | 1,2,2,3,3,4,4,5,6,7,8,9,10,11,11-pentadecafluoroundecane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C11H9F15O3S.C8H20N/c12-1(3(14)5(16)7(18)19)2(13)4(15)6(17)9(21,22)11(25,26)10(23,24)8(20)30(27,28)29;1-5-9(6-2,7-3)8-4/h1-8H,(H,27,28,29);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | FZKHVJNADJSZHC-UHFFFAOYSA-M |
| XLogP | 5.91 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|