C16H29F8NO3S — CID 134207072
2,3,4,5,6,7,8,8-octafluorooctane-1-sulfonate;tetraethylazanium (PubChem CID 134207072) has the molecular formula C16H29F8NO3S and a molecular weight of 467.46 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,8-octafluorooctane-1-sulfonate;tetraethylazanium.
| Compound Name | 2,3,4,5,6,7,8,8-octafluorooctane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 134207072 |
| Molecular Formula | C16H29F8NO3S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2,3,4,5,6,7,8,8-octafluorooctane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CC(F)C(F)C(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C8H10F8O3S.C8H20N/c9-2(1-20(17,18)19)3(10)4(11)5(12)6(13)7(14)8(15)16;1-5-9(6-2,7-3)8-4/h2-8H,1H2,(H,17,18,19);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | FSEWVGZMHBPIGF-UHFFFAOYSA-M |
| XLogP | 3.71 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|