C17H37F2NO3S — CID 134207269
2,9-difluorononane-1-sulfonate;tetraethylazanium (PubChem CID 134207269) has the molecular formula C17H37F2NO3S and a molecular weight of 373.55 g/mol. Its IUPAC name is 2,9-difluorononane-1-sulfonate;tetraethylazanium.
| Compound Name | 2,9-difluorononane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 134207269 |
| Molecular Formula | C17H37F2NO3S |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 2,9-difluorononane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CC(F)CCCCCCCF |
| InChI | InChI=1S/C9H18F2O3S.C8H20N/c10-7-5-3-1-2-4-6-9(11)8-15(12,13)14;1-5-9(6-2,7-3)8-4/h9H,1-8H2,(H,12,13,14);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | YUNWWAVRQLUUHI-UHFFFAOYSA-M |
| XLogP | 4.06 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|