C20H36F9NO3S — CID 134206846
2,3,4,5,6,7,8,9,12-nonafluorododecane-1-sulfonate;tetraethylazanium (PubChem CID 134206846) has the molecular formula C20H36F9NO3S and a molecular weight of 541.56 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,12-nonafluorododecane-1-sulfonate;tetraethylazanium.
| Compound Name | 2,3,4,5,6,7,8,9,12-nonafluorododecane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 134206846 |
| Molecular Formula | C20H36F9NO3S |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 2,3,4,5,6,7,8,9,12-nonafluorododecane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CC(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)CCCF |
| InChI | InChI=1S/C12H17F9O3S.C8H20N/c13-3-1-2-5(14)7(16)9(18)11(20)12(21)10(19)8(17)6(15)4-25(22,23)24;1-5-9(6-2,7-3)8-4/h5-12H,1-4H2,(H,22,23,24);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | IYXPBFVQRIYSLU-UHFFFAOYSA-M |
| XLogP | 4.87 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|