C12H20F5KO3S — CID 134206749
potassium 2,3,4,5,12-pentafluorododecane-1-sulfonate (PubChem CID 134206749) has the molecular formula C12H20F5KO3S and a molecular weight of 378.44 g/mol. Its IUPAC name is potassium 2,3,4,5,12-pentafluorododecane-1-sulfonate.
| Compound Name | potassium 2,3,4,5,12-pentafluorododecane-1-sulfonate |
|---|---|
| PubChem CID | 134206749 |
| Molecular Formula | C12H20F5KO3S |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | potassium 2,3,4,5,12-pentafluorododecane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(F)C(F)C(F)C(F)CCCCCCCF.[K+] |
| InChI | InChI=1S/C12H21F5O3S.K/c13-7-5-3-1-2-4-6-9(14)11(16)12(17)10(15)8-21(18,19)20;/h9-12H,1-8H2,(H,18,19,20);/q;+1/p-1 |
| InChIKey | QSXGERIIXSFBMN-UHFFFAOYSA-M |
| XLogP | 0.20 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|