C10H18F3LiO3S — CID 134207596
lithium 2,3,10-trifluorodecane-1-sulfonate (PubChem CID 134207596) has the molecular formula C10H18F3LiO3S and a molecular weight of 282.25 g/mol. Its IUPAC name is lithium 2,3,10-trifluorodecane-1-sulfonate.
| Compound Name | lithium 2,3,10-trifluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 134207596 |
| Molecular Formula | C10H18F3LiO3S |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | lithium 2,3,10-trifluorodecane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(F)C(F)CCCCCCCF.[Li+] |
| InChI | InChI=1S/C10H19F3O3S.Li/c11-7-5-3-1-2-4-6-9(12)10(13)8-17(14,15)16;/h9-10H,1-8H2,(H,14,15,16);/q;+1/p-1 |
| InChIKey | IXEQLTSLVOXZNY-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|