C14H28F3NO3S — CID 175164569
prop-2-en-1-amine;2,3,11-trifluoroundecane-1-sulfonic acid (PubChem CID 175164569) has the molecular formula C14H28F3NO3S and a molecular weight of 347.44 g/mol. Its IUPAC name is prop-2-en-1-amine;2,3,11-trifluoroundecane-1-sulfonic acid.
| Compound Name | prop-2-en-1-amine;2,3,11-trifluoroundecane-1-sulfonic acid |
|---|---|
| PubChem CID | 175164569 |
| Molecular Formula | C14H28F3NO3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | prop-2-en-1-amine;2,3,11-trifluoroundecane-1-sulfonic acid |
| SMILES | C=CCN.O=S(=O)(O)CC(F)C(F)CCCCCCCCF |
| InChI | InChI=1S/C11H21F3O3S.C3H7N/c12-8-6-4-2-1-3-5-7-10(13)11(14)9-18(15,16)17;1-2-3-4/h10-11H,1-9H2,(H,15,16,17);2H,1,3-4H2 |
| InChIKey | YAVDHQUCYSPGPT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|