C12H21F6NO3S — CID 175528961
2,3,4,5,6,9-hexafluorononane-1-sulfonic acid;prop-2-en-1-amine (PubChem CID 175528961) has the molecular formula C12H21F6NO3S and a molecular weight of 373.36 g/mol. Its IUPAC name is 2,3,4,5,6,9-hexafluorononane-1-sulfonic acid;prop-2-en-1-amine.
| Compound Name | 2,3,4,5,6,9-hexafluorononane-1-sulfonic acid;prop-2-en-1-amine |
|---|---|
| PubChem CID | 175528961 |
| Molecular Formula | C12H21F6NO3S |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2,3,4,5,6,9-hexafluorononane-1-sulfonic acid;prop-2-en-1-amine |
| SMILES | C=CCN.O=S(=O)(O)CC(F)C(F)C(F)C(F)C(F)CCCF |
| InChI | InChI=1S/C9H14F6O3S.C3H7N/c10-3-1-2-5(11)7(13)9(15)8(14)6(12)4-19(16,17)18;1-2-3-4/h5-9H,1-4H2,(H,16,17,18);2H,1,3-4H2 |
| InChIKey | QXKLIUQGWGTSTH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|