C13H20F9NO3S — CID 175164014
2,3,4,5,6,7,8,9,10-nonafluorodecane-1-sulfonic acid;prop-2-en-1-amine (PubChem CID 175164014) has the molecular formula C13H20F9NO3S and a molecular weight of 441.36 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10-nonafluorodecane-1-sulfonic acid;prop-2-en-1-amine.
| Compound Name | 2,3,4,5,6,7,8,9,10-nonafluorodecane-1-sulfonic acid;prop-2-en-1-amine |
|---|---|
| PubChem CID | 175164014 |
| Molecular Formula | C13H20F9NO3S |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10-nonafluorodecane-1-sulfonic acid;prop-2-en-1-amine |
| SMILES | C=CCN.O=S(=O)(O)CC(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)CF |
| InChI | InChI=1S/C10H13F9O3S.C3H7N/c11-1-3(12)5(14)7(16)9(18)10(19)8(17)6(15)4(13)2-23(20,21)22;1-2-3-4/h3-10H,1-2H2,(H,20,21,22);2H,1,3-4H2 |
| InChIKey | UESDUAVWUBVGLY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|