C14H25F6NO3S — CID 175529513
azane;prop-2-enyl 2,3,4,5,6,11-hexafluoroundecane-1-sulfonate (PubChem CID 175529513) has the molecular formula C14H25F6NO3S and a molecular weight of 401.41 g/mol. Its IUPAC name is azane;prop-2-enyl 2,3,4,5,6,11-hexafluoroundecane-1-sulfonate.
| Compound Name | azane;prop-2-enyl 2,3,4,5,6,11-hexafluoroundecane-1-sulfonate |
|---|---|
| PubChem CID | 175529513 |
| Molecular Formula | C14H25F6NO3S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | azane;prop-2-enyl 2,3,4,5,6,11-hexafluoroundecane-1-sulfonate |
| SMILES | C=CCOS(=O)(=O)CC(F)C(F)C(F)C(F)C(F)CCCCCF.N |
| InChI | InChI=1S/C14H22F6O3S.H3N/c1-2-8-23-24(21,22)9-11(17)13(19)14(20)12(18)10(16)6-4-3-5-7-15;/h2,10-14H,1,3-9H2;1H3 |
| InChIKey | SMUANTLVCLXPGT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|