C19H29F9O3 — CID 175292970
1,2,3,4,5,6,7,8,16-nonafluorohexadecan-1-ol;prop-2-enoic acid (PubChem CID 175292970) has the molecular formula C19H29F9O3 and a molecular weight of 476.42 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,16-nonafluorohexadecan-1-ol;prop-2-enoic acid.
| Compound Name | 1,2,3,4,5,6,7,8,16-nonafluorohexadecan-1-ol;prop-2-enoic acid |
|---|---|
| PubChem CID | 175292970 |
| Molecular Formula | C19H29F9O3 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1,2,3,4,5,6,7,8,16-nonafluorohexadecan-1-ol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.OC(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)CCCCCCCCF |
| InChI | InChI=1S/C16H25F9O.C3H4O2/c17-8-6-4-2-1-3-5-7-9(18)10(19)11(20)12(21)13(22)14(23)15(24)16(25)26;1-2-3(4)5/h9-16,26H,1-8H2;2H,1H2,(H,4,5) |
| InChIKey | LDYPDLCVLZSPBU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|