C10H16F6O — CID 166745270
1,2,3,4,5,10-hexafluorodecan-1-ol (PubChem CID 166745270) has the molecular formula C10H16F6O and a molecular weight of 266.23 g/mol. Its IUPAC name is 1,2,3,4,5,10-hexafluorodecan-1-ol.
| Compound Name | 1,2,3,4,5,10-hexafluorodecan-1-ol |
|---|---|
| PubChem CID | 166745270 |
| Molecular Formula | C10H16F6O |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1,2,3,4,5,10-hexafluorodecan-1-ol |
| SMILES | OC(F)C(F)C(F)C(F)C(F)CCCCCF |
| InChI | InChI=1S/C10H16F6O/c11-5-3-1-2-4-6(12)7(13)8(14)9(15)10(16)17/h6-10,17H,1-5H2 |
| InChIKey | YAPKLVVTFJOEIL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|