C9H15F5O — CID 166745168
1,2,3,4,9-pentafluorononan-1-ol (PubChem CID 166745168) has the molecular formula C9H15F5O and a molecular weight of 234.21 g/mol. Its IUPAC name is 1,2,3,4,9-pentafluorononan-1-ol.
| Compound Name | 1,2,3,4,9-pentafluorononan-1-ol |
|---|---|
| PubChem CID | 166745168 |
| Molecular Formula | C9H15F5O |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1,2,3,4,9-pentafluorononan-1-ol |
| SMILES | OC(F)C(F)C(F)C(F)CCCCCF |
| InChI | InChI=1S/C9H15F5O/c10-5-3-1-2-4-6(11)7(12)8(13)9(14)15/h6-9,15H,1-5H2 |
| InChIKey | LGURFYNPXWQAAM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|