C9H17F4NaO3S — CID 175360951
sodium;hydride;2,3,4,9-tetrafluorononane-1-sulfonic acid (PubChem CID 175360951) has the molecular formula C9H17F4NaO3S and a molecular weight of 304.28 g/mol. Its IUPAC name is sodium;hydride;2,3,4,9-tetrafluorononane-1-sulfonic acid.
| Compound Name | sodium;hydride;2,3,4,9-tetrafluorononane-1-sulfonic acid |
|---|---|
| PubChem CID | 175360951 |
| Molecular Formula | C9H17F4NaO3S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | sodium;hydride;2,3,4,9-tetrafluorononane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CC(F)C(F)C(F)CCCCCF.[H-].[Na+] |
| InChI | InChI=1S/C9H16F4O3S.Na.H/c10-5-3-1-2-4-7(11)9(13)8(12)6-17(14,15)16;;/h7-9H,1-6H2,(H,14,15,16);;/q;+1;-1 |
| InChIKey | HRTKFVQZANAGSV-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|