C18H37F4NO3S — CID 134206650
tetraethylazanium;2,3,4,10-tetrafluorodecane-1-sulfonate (PubChem CID 134206650) has the molecular formula C18H37F4NO3S and a molecular weight of 423.56 g/mol. Its IUPAC name is tetraethylazanium;2,3,4,10-tetrafluorodecane-1-sulfonate.
| Compound Name | tetraethylazanium;2,3,4,10-tetrafluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 134206650 |
| Molecular Formula | C18H37F4NO3S |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tetraethylazanium;2,3,4,10-tetrafluorodecane-1-sulfonate |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CC(F)C(F)C(F)CCCCCCF |
| InChI | InChI=1S/C10H18F4O3S.C8H20N/c11-6-4-2-1-3-5-8(12)10(14)9(13)7-18(15,16)17;1-5-9(6-2,7-3)8-4/h8-10H,1-7H2,(H,15,16,17);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | VHFMEGAKHKYYCE-UHFFFAOYSA-M |
| XLogP | 4.35 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|