C6H10F3NaO3S — CID 134207601
sodium 2,3,6-trifluorohexane-1-sulfonate (PubChem CID 134207601) has the molecular formula C6H10F3NaO3S and a molecular weight of 242.19 g/mol. Its IUPAC name is sodium 2,3,6-trifluorohexane-1-sulfonate.
| Compound Name | sodium 2,3,6-trifluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 134207601 |
| Molecular Formula | C6H10F3NaO3S |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | sodium 2,3,6-trifluorohexane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(F)C(F)CCCF.[Na+] |
| InChI | InChI=1S/C6H11F3O3S.Na/c7-3-1-2-5(8)6(9)4-13(10,11)12;/h5-6H,1-4H2,(H,10,11,12);/q;+1/p-1 |
| InChIKey | ZWKYRYVGHJNTEY-UHFFFAOYSA-M |
| XLogP | -2.04 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|