C6H9F4KO3S — CID 134207453
potassium 2,3,4,6-tetrafluorohexane-1-sulfonate (PubChem CID 134207453) has the molecular formula C6H9F4KO3S and a molecular weight of 276.29 g/mol. Its IUPAC name is potassium 2,3,4,6-tetrafluorohexane-1-sulfonate.
| Compound Name | potassium 2,3,4,6-tetrafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 134207453 |
| Molecular Formula | C6H9F4KO3S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | potassium 2,3,4,6-tetrafluorohexane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(F)C(F)C(F)CCF.[K+] |
| InChI | InChI=1S/C6H10F4O3S.K/c7-2-1-4(8)6(10)5(9)3-14(11,12)13;/h4-6H,1-3H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey | RJUPUMIARVVKAQ-UHFFFAOYSA-M |
| XLogP | -2.09 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|