C20H42F3NO3S — CID 134207029
tetraethylazanium;2,3,12-trifluorododecane-1-sulfonate (PubChem CID 134207029) has the molecular formula C20H42F3NO3S and a molecular weight of 433.62 g/mol. Its IUPAC name is tetraethylazanium;2,3,12-trifluorododecane-1-sulfonate.
| Compound Name | tetraethylazanium;2,3,12-trifluorododecane-1-sulfonate |
|---|---|
| PubChem CID | 134207029 |
| Molecular Formula | C20H42F3NO3S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | tetraethylazanium;2,3,12-trifluorododecane-1-sulfonate |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CC(F)C(F)CCCCCCCCCF |
| InChI | InChI=1S/C12H23F3O3S.C8H20N/c13-9-7-5-3-1-2-4-6-8-11(14)12(15)10-19(16,17)18;1-5-9(6-2,7-3)8-4/h11-12H,1-10H2,(H,16,17,18);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | AMSJKCPZFOOHSK-UHFFFAOYSA-M |
| XLogP | 5.18 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|