C11H21F3O3S — CID 134206558
2,3,11-trifluoroundecane-1-sulfonic acid (PubChem CID 134206558) has the molecular formula C11H21F3O3S and a molecular weight of 290.35 g/mol. Its IUPAC name is 2,3,11-trifluoroundecane-1-sulfonic acid.
| Compound Name | 2,3,11-trifluoroundecane-1-sulfonic acid |
|---|---|
| PubChem CID | 134206558 |
| Molecular Formula | C11H21F3O3S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2,3,11-trifluoroundecane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CC(F)C(F)CCCCCCCCF |
| InChI | InChI=1S/C11H21F3O3S/c12-8-6-4-2-1-3-5-7-10(13)11(14)9-18(15,16)17/h10-11H,1-9H2,(H,15,16,17) |
| InChIKey | KDHPKBWMFJMODM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|