C10H18F4O4 — CID 166745188
3,4,5,10-tetrafluorodecane-1,1,1,2-tetrol (PubChem CID 166745188) has the molecular formula C10H18F4O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 3,4,5,10-tetrafluorodecane-1,1,1,2-tetrol.
| Compound Name | 3,4,5,10-tetrafluorodecane-1,1,1,2-tetrol |
|---|---|
| PubChem CID | 166745188 |
| Molecular Formula | C10H18F4O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3,4,5,10-tetrafluorodecane-1,1,1,2-tetrol |
| SMILES | OC(C(F)C(F)C(F)CCCCCF)C(O)(O)O |
| InChI | InChI=1S/C10H18F4O4/c11-5-3-1-2-4-6(12)7(13)8(14)9(15)10(16,17)18/h6-9,15-18H,1-5H2 |
| InChIKey | RHCPCEXKEOQSCO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|