C8H13BaF7 — CID 173311743
barium(2+);1,1,2,3,4,5,8-heptafluorooctane;hydride (PubChem CID 173311743) has the molecular formula C8H13BaF7 and a molecular weight of 379.51 g/mol. Its IUPAC name is barium(2+);1,1,2,3,4,5,8-heptafluorooctane;hydride.
| Compound Name | barium(2+);1,1,2,3,4,5,8-heptafluorooctane;hydride |
|---|---|
| PubChem CID | 173311743 |
| Molecular Formula | C8H13BaF7 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | barium(2+);1,1,2,3,4,5,8-heptafluorooctane;hydride |
| SMILES | FCCCC(F)C(F)C(F)C(F)C(F)F.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C8H11F7.Ba.2H/c9-3-1-2-4(10)5(11)6(12)7(13)8(14)15;;;/h4-8H,1-3H2;;;/q;+2;2*-1 |
| InChIKey | CLFGAGGECMCPLH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |