C12H14F10 — CID 173057318
1,3,4,5,6,7,8,9,10,12-decafluorododec-1-ene (PubChem CID 173057318) has the molecular formula C12H14F10 and a molecular weight of 348.22 g/mol. Its IUPAC name is 1,3,4,5,6,7,8,9,10,12-decafluorododec-1-ene.
| Compound Name | 1,3,4,5,6,7,8,9,10,12-decafluorododec-1-ene |
|---|---|
| PubChem CID | 173057318 |
| Molecular Formula | C12H14F10 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1,3,4,5,6,7,8,9,10,12-decafluorododec-1-ene |
| SMILES | FC=CC(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)CCF |
| InChI | InChI=1S/C12H14F10/c13-3-1-5(15)7(17)9(19)11(21)12(22)10(20)8(18)6(16)2-4-14/h1,3,5-12H,2,4H2 |
| InChIKey | NNOZNZLMRJADEJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |