C6H7BrF4 — CID 155208912
6-bromo-1,3,4,6-tetrafluorohex-1-ene (PubChem CID 155208912) has the molecular formula C6H7BrF4 and a molecular weight of 235.02 g/mol. Its IUPAC name is 6-bromo-1,3,4,6-tetrafluorohex-1-ene.
| Compound Name | 6-bromo-1,3,4,6-tetrafluorohex-1-ene |
|---|---|
| PubChem CID | 155208912 |
| Molecular Formula | C6H7BrF4 |
| Molecular Weight | 235.02 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | 6-bromo-1,3,4,6-tetrafluorohex-1-ene |
| SMILES | FC=CC(F)C(F)CC(F)Br |
| InChI | InChI=1S/C6H7BrF4/c7-6(11)3-5(10)4(9)1-2-8/h1-2,4-6H,3H2 |
| InChIKey | PUHPYEYQZUYVPA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.02 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|