About 1-bromo-1,2,3-trifluoropropane
1-bromo-1,2,3-trifluoropropane (PubChem CID 5463736) has the molecular formula C3H4BrF3
and a molecular weight of 176.96 g/mol. Its IUPAC name is 1-bromo-1,2,3-trifluoropropane.
Molecular Properties
| Compound Name | 1-bromo-1,2,3-trifluoropropane |
| PubChem CID | 5463736 |
| Molecular Formula | C3H4BrF3 |
| Molecular Weight | 176.96 g/mol |
| Exact Mass | 175.94 |
| IUPAC Name | 1-bromo-1,2,3-trifluoropropane |
| SMILES | FCC(F)C(F)Br |
| InChI | InChI=1S/C3H4BrF3/c4-3(7)2(6)1-5/h2-3H,1H2 |
| InChIKey | ITYJYNGFTKERPR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.96 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-1,2,3-trifluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-1,2,3-trifluoropropane?
The IUPAC name of 1-bromo-1,2,3-trifluoropropane (CID 5463736) is 1-bromo-1,2,3-trifluoropropane.
What is the SMILES notation for 1-bromo-1,2,3-trifluoropropane?
The canonical SMILES for 1-bromo-1,2,3-trifluoropropane is FCC(F)C(F)Br.
What is the InChIKey of 1-bromo-1,2,3-trifluoropropane?
The InChIKey is ITYJYNGFTKERPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4BrF3/c4-3(7)2(6)1-5/h2-3H,1H2.
What are the key properties of 1-bromo-1,2,3-trifluoropropane?
1-bromo-1,2,3-trifluoropropane has a molecular weight of 176.96 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-1,2,3-trifluoropropane is sourced from PubChem (CID 5463736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).